C22H19IN2O8 — CID 19664666
ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19664666) has the molecular formula C22H19IN2O8 and a molecular weight of 566.30 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19664666 |
| Molecular Formula | C22H19IN2O8 |
| Molecular Weight | 566.30 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3cccc([N+](=O)[O-])c3)OC2=O)cc1OCC |
| InChI | InChI=1S/C22H19IN2O8/c1-3-30-18-10-13(8-16(23)20(18)32-12-19(26)31-4-2)9-17-22(27)33-21(24-17)14-6-5-7-15(11-14)25(28)29/h5-11H,3-4,12H2,1-2H3/b17-9- |
| InChIKey | HFBGGNSXJBRHKZ-MFOYZWKCSA-N |
| XLogP | 3.88 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|