C22H19FINO4 — CID 3121184
4-[[3-ethoxy-5-iodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 3121184) has the molecular formula C22H19FINO4 and a molecular weight of 507.30 g/mol. Its IUPAC name is 4-[[3-ethoxy-5-iodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[3-ethoxy-5-iodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3121184 |
| Molecular Formula | C22H19FINO4 |
| Molecular Weight | 507.30 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 4-[[3-ethoxy-5-iodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | C=C(C)COc1c(I)cc(C=C2N=C(c3cccc(F)c3)OC2=O)cc1OCC |
| InChI | InChI=1S/C22H19FINO4/c1-4-27-19-10-14(8-17(24)20(19)28-12-13(2)3)9-18-22(26)29-21(25-18)15-6-5-7-16(23)11-15/h5-11H,2,4,12H2,1,3H3 |
| InChIKey | RZMKHYCNKXKRIV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|