C27H22INO6 — CID 19665689
methyl 2-[2-ethoxy-6-iodo-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19665689) has the molecular formula C27H22INO6 and a molecular weight of 583.38 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-6-iodo-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-6-iodo-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19665689 |
| Molecular Formula | C27H22INO6 |
| Molecular Weight | 583.38 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | methyl 2-[2-ethoxy-6-iodo-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(-c4ccccc4)cc3)OC2=O)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C27H22INO6/c1-3-33-23-15-17(13-21(28)25(23)34-16-24(30)32-2)14-22-27(31)35-26(29-22)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-15H,3,16H2,1-2H3/b22-14- |
| InChIKey | YBBDTNBRICUUBR-HMAPJEAMSA-N |
| XLogP | 5.25 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|