C20H14I3NO5 — CID 19671991
methyl 2-[2,6-diiodo-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19671991) has the molecular formula C20H14I3NO5 and a molecular weight of 729.05 g/mol. Its IUPAC name is methyl 2-[2,6-diiodo-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-diiodo-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19671991 |
| Molecular Formula | C20H14I3NO5 |
| Molecular Weight | 729.05 g/mol |
| Exact Mass | 728.80 |
| IUPAC Name | methyl 2-[2,6-diiodo-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2\N=C(c3ccc(I)c(C)c3)OC2=O)cc1I |
| InChI | InChI=1S/C20H14I3NO5/c1-10-5-12(3-4-13(10)21)19-24-16(20(26)29-19)8-11-6-14(22)18(15(23)7-11)28-9-17(25)27-2/h3-8H,9H2,1-2H3/b16-8- |
| InChIKey | VLOZBDUPALACEQ-PXNMLYILSA-N |
| XLogP | 4.71 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.05 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|