C19H12Br2INO5 — CID 19670879
methyl 2-[2,6-dibromo-4-[(Z)-[2-(4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19670879) has the molecular formula C19H12Br2INO5 and a molecular weight of 621.02 g/mol. Its IUPAC name is methyl 2-[2,6-dibromo-4-[(Z)-[2-(4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-dibromo-4-[(Z)-[2-(4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19670879 |
| Molecular Formula | C19H12Br2INO5 |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 618.81 |
| IUPAC Name | methyl 2-[2,6-dibromo-4-[(Z)-[2-(4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=C2\N=C(c3ccc(I)cc3)OC2=O)cc1Br |
| InChI | InChI=1S/C19H12Br2INO5/c1-26-16(24)9-27-17-13(20)6-10(7-14(17)21)8-15-19(25)28-18(23-15)11-2-4-12(22)5-3-11/h2-8H,9H2,1H3/b15-8- |
| InChIKey | DJZUQPNTYLFYOD-NVNXTCNLSA-N |
| XLogP | 4.71 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|