C22H18Br2N2O4 — CID 19666492
N-[4-[(4Z)-4-[[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 19666492) has the molecular formula C22H18Br2N2O4 and a molecular weight of 534.20 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4Z)-4-[[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 19666492 |
| Molecular Formula | C22H18Br2N2O4 |
| Molecular Weight | 534.20 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | N-[4-[(4Z)-4-[[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | C=C(C)COc1c(Br)cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)cc1Br |
| InChI | InChI=1S/C22H18Br2N2O4/c1-12(2)11-29-20-17(23)8-14(9-18(20)24)10-19-22(28)30-21(26-19)15-4-6-16(7-5-15)25-13(3)27/h4-10H,1,11H2,2-3H3,(H,25,27)/b19-10- |
| InChIKey | RSONGYCKXLINNB-GRSHGNNSSA-N |
| XLogP | 5.47 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.20 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|