C26H18Br2N2O5 — CID 19666647
[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dibromophenyl] 4-methylbenzoate (PubChem CID 19666647) has the molecular formula C26H18Br2N2O5 and a molecular weight of 598.25 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dibromophenyl] 4-methylbenzoate.
| Compound Name | [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dibromophenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19666647 |
| Molecular Formula | C26H18Br2N2O5 |
| Molecular Weight | 598.25 g/mol |
| Exact Mass | 595.96 |
| IUPAC Name | [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dibromophenyl] 4-methylbenzoate |
| SMILES | CC(=O)Nc1ccc(C2=N/C(=C\c3cc(Br)c(OC(=O)c4ccc(C)cc4)c(Br)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H18Br2N2O5/c1-14-3-5-18(6-4-14)25(32)34-23-20(27)11-16(12-21(23)28)13-22-26(33)35-24(30-22)17-7-9-19(10-8-17)29-15(2)31/h3-13H,1-2H3,(H,29,31)/b22-13- |
| InChIKey | HQFBQCYKJRKKBF-XKZIYDEJSA-N |
| XLogP | 6.04 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.25 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|