C25H17Br2FN2O4 — CID 19666370
N-[4-[(4Z)-4-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 19666370) has the molecular formula C25H17Br2FN2O4 and a molecular weight of 588.23 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4Z)-4-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 19666370 |
| Molecular Formula | C25H17Br2FN2O4 |
| Molecular Weight | 588.23 g/mol |
| Exact Mass | 585.95 |
| IUPAC Name | N-[4-[(4Z)-4-[[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=N/C(=C\c3cc(Br)c(OCc4ccccc4F)c(Br)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H17Br2FN2O4/c1-14(31)29-18-8-6-16(7-9-18)24-30-22(25(32)34-24)12-15-10-19(26)23(20(27)11-15)33-13-17-4-2-3-5-21(17)28/h2-12H,13H2,1H3,(H,29,31)/b22-12- |
| InChIKey | ZFYFWNGNSUFJCN-UUYOSTAYSA-N |
| XLogP | 6.23 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.23 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|