C22H19BrN2O6 — CID 19666203
[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-bromo-6-ethoxyphenyl] acetate (PubChem CID 19666203) has the molecular formula C22H19BrN2O6 and a molecular weight of 487.31 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-bromo-6-ethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-bromo-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 19666203 |
| Molecular Formula | C22H19BrN2O6 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-bromo-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C22H19BrN2O6/c1-4-29-19-11-14(9-17(23)20(19)30-13(3)27)10-18-22(28)31-21(25-18)15-5-7-16(8-6-15)24-12(2)26/h5-11H,4H2,1-3H3,(H,24,26)/b18-10- |
| InChIKey | UKRJMXFITGOAJM-ZDLGFXPLSA-N |
| XLogP | 4.08 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|