C26H19BrClNO5 — CID 19662184
[2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 19662184) has the molecular formula C26H19BrClNO5 and a molecular weight of 540.80 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 19662184 |
| Molecular Formula | C26H19BrClNO5 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(C)cc3)OC2=O)cc(Br)c1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H19BrClNO5/c1-3-32-22-14-16(12-19(27)23(22)33-25(30)18-6-4-5-7-20(18)28)13-21-26(31)34-24(29-21)17-10-8-15(2)9-11-17/h4-14H,3H2,1-2H3/b21-13- |
| InChIKey | QUJQOTQHMRGIGR-BKUYFWCQSA-N |
| XLogP | 6.37 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|