C27H21BrINO5 — CID 19672048
[2-bromo-6-ethoxy-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 19672048) has the molecular formula C27H21BrINO5 and a molecular weight of 646.28 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19672048 |
| Molecular Formula | C27H21BrINO5 |
| Molecular Weight | 646.28 g/mol |
| Exact Mass | 644.96 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(I)c(C)c3)OC2=O)cc(Br)c1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C27H21BrINO5/c1-4-33-23-14-17(12-20(28)24(23)34-26(31)19-8-6-5-7-15(19)2)13-22-27(32)35-25(30-22)18-9-10-21(29)16(3)11-18/h5-14H,4H2,1-3H3/b22-13- |
| InChIKey | HRRBJGIVCFPRFA-XKZIYDEJSA-N |
| XLogP | 6.63 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.28 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|