C22H19IN2O7 — CID 19666610
methyl 2-[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 19666610) has the molecular formula C22H19IN2O7 and a molecular weight of 550.31 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 19666610 |
| Molecular Formula | C22H19IN2O7 |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | methyl 2-[4-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C22H19IN2O7/c1-12(26)24-15-6-4-14(5-7-15)21-25-17(22(28)32-21)9-13-8-16(23)20(18(10-13)29-2)31-11-19(27)30-3/h4-10H,11H2,1-3H3,(H,24,26)/b17-9- |
| InChIKey | MEBDZUPIAOHBTI-MFOYZWKCSA-N |
| XLogP | 3.15 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|