C22H20INO6 — CID 19662144
ethyl 2-[2-iodo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19662144) has the molecular formula C22H20INO6 and a molecular weight of 521.31 g/mol. Its IUPAC name is ethyl 2-[2-iodo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-iodo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19662144 |
| Molecular Formula | C22H20INO6 |
| Molecular Weight | 521.31 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | ethyl 2-[2-iodo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3ccc(C)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C22H20INO6/c1-4-28-19(25)12-29-20-16(23)9-14(11-18(20)27-3)10-17-22(26)30-21(24-17)15-7-5-13(2)6-8-15/h5-11H,4,12H2,1-3H3/b17-10- |
| InChIKey | SKSGGGBTTWYDHC-YVLHZVERSA-N |
| XLogP | 3.89 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|