C23H22INO6 — CID 19668137
ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19668137) has the molecular formula C23H22INO6 and a molecular weight of 535.33 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19668137 |
| Molecular Formula | C23H22INO6 |
| Molecular Weight | 535.33 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3ccccc3C)OC2=O)cc1OCC |
| InChI | InChI=1S/C23H22INO6/c1-4-28-19-12-15(10-17(24)21(19)30-13-20(26)29-5-2)11-18-23(27)31-22(25-18)16-9-7-6-8-14(16)3/h6-12H,4-5,13H2,1-3H3/b18-11- |
| InChIKey | AGLIGTVSOHKYRL-WQRHYEAKSA-N |
| XLogP | 4.28 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|