C22H18Cl2INO6 — CID 19670380
ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 19670380) has the molecular formula C22H18Cl2INO6 and a molecular weight of 590.20 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 19670380 |
| Molecular Formula | C22H18Cl2INO6 |
| Molecular Weight | 590.20 g/mol |
| Exact Mass | 588.96 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc1OCC |
| InChI | InChI=1S/C22H18Cl2INO6/c1-3-29-18-9-12(7-16(25)20(18)31-11-19(27)30-4-2)8-17-22(28)32-21(26-17)14-6-5-13(23)10-15(14)24/h5-10H,3-4,11H2,1-2H3/b17-8- |
| InChIKey | RSVAEGMXEBLAAM-IUXPMGMMSA-N |
| XLogP | 5.28 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.20 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|