C20H14Cl3NO5 — CID 3103909
[2-chloro-4-[[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] acetate (PubChem CID 3103909) has the molecular formula C20H14Cl3NO5 and a molecular weight of 454.69 g/mol. Its IUPAC name is [2-chloro-4-[[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] acetate.
| Compound Name | [2-chloro-4-[[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 3103909 |
| Molecular Formula | C20H14Cl3NO5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | [2-chloro-4-[[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(Cl)cc3Cl)OC2=O)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C20H14Cl3NO5/c1-3-27-17-8-11(6-15(23)18(17)28-10(2)25)7-16-20(26)29-19(24-16)13-5-4-12(21)9-14(13)22/h4-9H,3H2,1-2H3 |
| InChIKey | XSZSMZLPUWPLFV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|