C21H18Cl3NO4 — CID 19670040
(4Z)-4-[(3-chloro-5-ethoxy-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 19670040) has the molecular formula C21H18Cl3NO4 and a molecular weight of 454.74 g/mol. Its IUPAC name is (4Z)-4-[(3-chloro-5-ethoxy-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-chloro-5-ethoxy-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670040 |
| Molecular Formula | C21H18Cl3NO4 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | (4Z)-4-[(3-chloro-5-ethoxy-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | CCCOc1c(Cl)cc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc1OCC |
| InChI | InChI=1S/C21H18Cl3NO4/c1-3-7-28-19-16(24)8-12(10-18(19)27-4-2)9-17-21(26)29-20(25-17)14-6-5-13(22)11-15(14)23/h5-6,8-11H,3-4,7H2,1-2H3/b17-9- |
| InChIKey | QVOGEFYXKWBYJQ-MFOYZWKCSA-N |
| XLogP | 6.18 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|