C19H13Br2Cl2NO3 — CID 19670036
(4Z)-4-[(3,5-dibromo-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 19670036) has the molecular formula C19H13Br2Cl2NO3 and a molecular weight of 534.03 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3,5-dibromo-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670036 |
| Molecular Formula | C19H13Br2Cl2NO3 |
| Molecular Weight | 534.03 g/mol |
| Exact Mass | 530.86 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-propoxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | CCCOc1c(Br)cc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc1Br |
| InChI | InChI=1S/C19H13Br2Cl2NO3/c1-2-5-26-17-13(20)6-10(7-14(17)21)8-16-19(25)27-18(24-16)12-4-3-11(22)9-15(12)23/h3-4,6-9H,2,5H2,1H3/b16-8- |
| InChIKey | REAKHJGTKUNMRP-PXNMLYILSA-N |
| XLogP | 6.65 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.03 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|