C20H15Br2ClINO3 — CID 19673862
(4Z)-2-(2-chloro-5-iodophenyl)-4-[(3,5-dibromo-4-butoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19673862) has the molecular formula C20H15Br2ClINO3 and a molecular weight of 639.51 g/mol. Its IUPAC name is (4Z)-2-(2-chloro-5-iodophenyl)-4-[(3,5-dibromo-4-butoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[(3,5-dibromo-4-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19673862 |
| Molecular Formula | C20H15Br2ClINO3 |
| Molecular Weight | 639.51 g/mol |
| Exact Mass | 636.82 |
| IUPAC Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[(3,5-dibromo-4-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCOc1c(Br)cc(/C=C2\N=C(c3cc(I)ccc3Cl)OC2=O)cc1Br |
| InChI | InChI=1S/C20H15Br2ClINO3/c1-2-3-6-27-18-14(21)7-11(8-15(18)22)9-17-20(26)28-19(25-17)13-10-12(24)4-5-16(13)23/h4-5,7-10H,2-3,6H2,1H3/b17-9- |
| InChIKey | RRDULRGRICAYQF-MFOYZWKCSA-N |
| XLogP | 6.99 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|