C21H19ClINO4 — CID 19670826
(4Z)-4-[(4-butoxy-3-chloro-5-methoxyphenyl)methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one (PubChem CID 19670826) has the molecular formula C21H19ClINO4 and a molecular weight of 511.74 g/mol. Its IUPAC name is (4Z)-4-[(4-butoxy-3-chloro-5-methoxyphenyl)methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-butoxy-3-chloro-5-methoxyphenyl)methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670826 |
| Molecular Formula | C21H19ClINO4 |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | (4Z)-4-[(4-butoxy-3-chloro-5-methoxyphenyl)methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one |
| SMILES | CCCCOc1c(Cl)cc(/C=C2\N=C(c3ccc(I)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H19ClINO4/c1-3-4-9-27-19-16(22)10-13(12-18(19)26-2)11-17-21(25)28-20(24-17)14-5-7-15(23)8-6-14/h5-8,10-12H,3-4,9H2,1-2H3/b17-11- |
| InChIKey | NJMQXCBWGMZAHS-BOPFTXTBSA-N |
| XLogP | 5.48 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|