C25H28ClNO4 — CID 19668632
(4Z)-4-[(4-butoxy-3-chloro-5-ethoxyphenyl)methylidene]-2-(4-propan-2-ylphenyl)-1,3-oxazol-5-one (PubChem CID 19668632) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is (4Z)-4-[(4-butoxy-3-chloro-5-ethoxyphenyl)methylidene]-2-(4-propan-2-ylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-butoxy-3-chloro-5-ethoxyphenyl)methylidene]-2-(4-propan-2-ylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19668632 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (4Z)-4-[(4-butoxy-3-chloro-5-ethoxyphenyl)methylidene]-2-(4-propan-2-ylphenyl)-1,3-oxazol-5-one |
| SMILES | CCCCOc1c(Cl)cc(/C=C2\N=C(c3ccc(C(C)C)cc3)OC2=O)cc1OCC |
| InChI | InChI=1S/C25H28ClNO4/c1-5-7-12-30-23-20(26)13-17(15-22(23)29-6-2)14-21-25(28)31-24(27-21)19-10-8-18(9-11-19)16(3)4/h8-11,13-16H,5-7,12H2,1-4H3/b21-14- |
| InChIKey | UKFQXDHWWANDHE-STZFKDTASA-N |
| XLogP | 6.39 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|