C23H10Br2Cl3NO4 — CID 19670415
[2,6-dibromo-4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 19670415) has the molecular formula C23H10Br2Cl3NO4 and a molecular weight of 630.50 g/mol. Its IUPAC name is [2,6-dibromo-4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2,6-dibromo-4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 19670415 |
| Molecular Formula | C23H10Br2Cl3NO4 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 626.80 |
| IUPAC Name | [2,6-dibromo-4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1cc(Br)c(OC(=O)c2ccccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C23H10Br2Cl3NO4/c24-15-7-11(8-16(25)20(15)32-22(30)14-3-1-2-4-17(14)27)9-19-23(31)33-21(29-19)13-6-5-12(26)10-18(13)28/h1-10H/b19-9- |
| InChIKey | UCQNHNNPPMMQTK-OCKHKDLRSA-N |
| XLogP | 7.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.50 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|