C26H17Br2Cl2NO7 — CID 126202380
[2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126202380) has the molecular formula C26H17Br2Cl2NO7 and a molecular weight of 686.14 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126202380 |
| Molecular Formula | C26H17Br2Cl2NO7 |
| Molecular Weight | 686.14 g/mol |
| Exact Mass | 682.87 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Br)cc(Br)cc2/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H17Br2Cl2NO7/c1-34-20-8-13(9-21(35-2)23(20)36-3)25(32)37-22-12(6-14(27)10-17(22)28)7-19-26(33)38-24(31-19)16-5-4-15(29)11-18(16)30/h4-11H,1-3H3/b19-7- |
| InChIKey | XGOHMUTZTSJORP-GXHLCREISA-N |
| XLogP | 7.11 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.14 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|