C28H21Br2NO7 — CID 126195624
[2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126195624) has the molecular formula C28H21Br2NO7 and a molecular weight of 643.28 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126195624 |
| Molecular Formula | C28H21Br2NO7 |
| Molecular Weight | 643.28 g/mol |
| Exact Mass | 640.97 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)/C=C/c3ccccc3)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C28H21Br2NO7/c1-34-22-13-18(14-23(35-2)26(22)36-3)27-31-21(28(33)38-27)12-17-11-19(29)15-20(30)25(17)37-24(32)10-9-16-7-5-4-6-8-16/h4-15H,1-3H3/b10-9+,21-12- |
| InChIKey | GAJHWDBRXFQXBZ-RTLHQRDBSA-N |
| XLogP | 6.20 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|