C17H10Br3NO3 — CID 6523197
(4Z)-2-(3-bromophenyl)-4-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6523197) has the molecular formula C17H10Br3NO3 and a molecular weight of 515.98 g/mol. Its IUPAC name is (4Z)-2-(3-bromophenyl)-4-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromophenyl)-4-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6523197 |
| Molecular Formula | C17H10Br3NO3 |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 512.82 |
| IUPAC Name | (4Z)-2-(3-bromophenyl)-4-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1c(Br)cc(Br)cc1/C=C1\N=C(c2cccc(Br)c2)OC1=O |
| InChI | InChI=1S/C17H10Br3NO3/c1-23-15-10(6-12(19)8-13(15)20)7-14-17(22)24-16(21-14)9-3-2-4-11(18)5-9/h2-8H,1H3/b14-7- |
| InChIKey | SMJZUUUVKJQDRN-AUWJEWJLSA-N |
| XLogP | 5.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|