C22H13Br2NO5 — CID 126201777
[2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126201777) has the molecular formula C22H13Br2NO5 and a molecular weight of 531.16 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126201777 |
| Molecular Formula | C22H13Br2NO5 |
| Molecular Weight | 531.16 g/mol |
| Exact Mass | 528.92 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | Cc1cccc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)c3ccco3)C(=O)O2)c1 |
| InChI | InChI=1S/C22H13Br2NO5/c1-12-4-2-5-13(8-12)20-25-17(21(26)30-20)10-14-9-15(23)11-16(24)19(14)29-22(27)18-6-3-7-28-18/h2-11H,1H3/b17-10- |
| InChIKey | QUKYHTHGGIKXGY-YVLHZVERSA-N |
| XLogP | 5.68 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.16 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|