C24H13Br2Cl2NO4 — CID 126202190
[2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126202190) has the molecular formula C24H13Br2Cl2NO4 and a molecular weight of 610.09 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126202190 |
| Molecular Formula | C24H13Br2Cl2NO4 |
| Molecular Weight | 610.09 g/mol |
| Exact Mass | 606.86 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1cccc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)c3ccc(Cl)cc3Cl)C(=O)O2)c1 |
| InChI | InChI=1S/C24H13Br2Cl2NO4/c1-12-3-2-4-13(7-12)22-29-20(24(31)33-22)9-14-8-15(25)10-18(26)21(14)32-23(30)17-6-5-16(27)11-19(17)28/h2-11H,1H3/b20-9- |
| InChIKey | XLTGYWCNZDWTBW-UKWGHVSLSA-N |
| XLogP | 7.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.09 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|