C19H11Br2Cl2NO4 — CID 126198706
[2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate (PubChem CID 126198706) has the molecular formula C19H11Br2Cl2NO4 and a molecular weight of 548.01 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 126198706 |
| Molecular Formula | C19H11Br2Cl2NO4 |
| Molecular Weight | 548.01 g/mol |
| Exact Mass | 544.84 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(Br)cc1/C=C1\N=C(c2ccc(Cl)cc2Cl)OC1=O |
| InChI | InChI=1S/C19H11Br2Cl2NO4/c1-2-16(25)27-17-9(5-10(20)7-13(17)21)6-15-19(26)28-18(24-15)12-4-3-11(22)8-14(12)23/h3-8H,2H2,1H3/b15-6- |
| InChIKey | XSMRYQIEBVZCKH-UUASQNMZSA-N |
| XLogP | 6.18 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.01 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|