C21H17ClN2O6 — CID 19674083
[4-[(Z)-[2-(2-chloro-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethylphenyl] propanoate (PubChem CID 19674083) has the molecular formula C21H17ClN2O6 and a molecular weight of 428.83 g/mol. Its IUPAC name is [4-[(Z)-[2-(2-chloro-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethylphenyl] propanoate.
| Compound Name | [4-[(Z)-[2-(2-chloro-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethylphenyl] propanoate |
|---|---|
| PubChem CID | 19674083 |
| Molecular Formula | C21H17ClN2O6 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [4-[(Z)-[2-(2-chloro-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethylphenyl] propanoate |
| SMILES | CCC(=O)Oc1c(C)cc(/C=C2\N=C(c3ccc([N+](=O)[O-])cc3Cl)OC2=O)cc1C |
| InChI | InChI=1S/C21H17ClN2O6/c1-4-18(25)29-19-11(2)7-13(8-12(19)3)9-17-21(26)30-20(23-17)15-6-5-14(24(27)28)10-16(15)22/h5-10H,4H2,1-3H3/b17-9- |
| InChIKey | VYTWMEREPKUXGD-MFOYZWKCSA-N |
| XLogP | 4.52 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|