C20H15ClI2N2O5 — CID 19674422
(4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 19674422) has the molecular formula C20H15ClI2N2O5 and a molecular weight of 652.61 g/mol. Its IUPAC name is (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19674422 |
| Molecular Formula | C20H15ClI2N2O5 |
| Molecular Weight | 652.61 g/mol |
| Exact Mass | 651.88 |
| IUPAC Name | (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | CCC(C)Oc1c(I)cc(/C=C2\N=C(c3ccc([N+](=O)[O-])cc3Cl)OC2=O)cc1I |
| InChI | InChI=1S/C20H15ClI2N2O5/c1-3-10(2)29-18-15(22)6-11(7-16(18)23)8-17-20(26)30-19(24-17)13-5-4-12(25(27)28)9-14(13)21/h4-10H,3H2,1-2H3/b17-8- |
| InChIKey | QLGJUYSDUGWZLK-IUXPMGMMSA-N |
| XLogP | 5.98 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|