C21H19I2NO3 — CID 19668160
(4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one (PubChem CID 19668160) has the molecular formula C21H19I2NO3 and a molecular weight of 587.20 g/mol. Its IUPAC name is (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19668160 |
| Molecular Formula | C21H19I2NO3 |
| Molecular Weight | 587.20 g/mol |
| Exact Mass | 586.95 |
| IUPAC Name | (4Z)-4-[(4-butan-2-yloxy-3,5-diiodophenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
| SMILES | CCC(C)Oc1c(I)cc(/C=C2\N=C(c3ccccc3C)OC2=O)cc1I |
| InChI | InChI=1S/C21H19I2NO3/c1-4-13(3)26-19-16(22)9-14(10-17(19)23)11-18-21(25)27-20(24-18)15-8-6-5-7-12(15)2/h5-11,13H,4H2,1-3H3/b18-11- |
| InChIKey | QKRHFZCVGXRRMN-WQRHYEAKSA-N |
| XLogP | 5.73 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.20 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|