C26H18BrCl2NO5 — CID 19670399
(4Z)-4-[(3-bromo-5-ethoxy-4-phenacyloxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 19670399) has the molecular formula C26H18BrCl2NO5 and a molecular weight of 575.24 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-5-ethoxy-4-phenacyloxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-bromo-5-ethoxy-4-phenacyloxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670399 |
| Molecular Formula | C26H18BrCl2NO5 |
| Molecular Weight | 575.24 g/mol |
| Exact Mass | 572.97 |
| IUPAC Name | (4Z)-4-[(3-bromo-5-ethoxy-4-phenacyloxyphenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc(Br)c1OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H18BrCl2NO5/c1-2-33-23-12-15(10-19(27)24(23)34-14-22(31)16-6-4-3-5-7-16)11-21-26(32)35-25(30-21)18-9-8-17(28)13-20(18)29/h3-13H,2,14H2,1H3/b21-11- |
| InChIKey | VTEQYKJTYZHGLG-NHDPSOOVSA-N |
| XLogP | 6.76 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.24 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|