C25H17Br2NO4 — CID 19668153
(4Z)-4-[(3,5-dibromo-4-phenacyloxyphenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one (PubChem CID 19668153) has the molecular formula C25H17Br2NO4 and a molecular weight of 555.22 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-phenacyloxyphenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3,5-dibromo-4-phenacyloxyphenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19668153 |
| Molecular Formula | C25H17Br2NO4 |
| Molecular Weight | 555.22 g/mol |
| Exact Mass | 552.95 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-phenacyloxyphenyl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccccc1C1=N/C(=C\c2cc(Br)c(OCC(=O)c3ccccc3)c(Br)c2)C(=O)O1 |
| InChI | InChI=1S/C25H17Br2NO4/c1-15-7-5-6-10-18(15)24-28-21(25(30)32-24)13-16-11-19(26)23(20(27)12-16)31-14-22(29)17-8-3-2-4-9-17/h2-13H,14H2,1H3/b21-13- |
| InChIKey | TZNNZGOBKVCCPP-BKUYFWCQSA-N |
| XLogP | 6.13 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.22 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|