C23H12Br3NO4 — CID 19669478
[2,6-dibromo-4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 19669478) has the molecular formula C23H12Br3NO4 and a molecular weight of 606.06 g/mol. Its IUPAC name is [2,6-dibromo-4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2,6-dibromo-4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19669478 |
| Molecular Formula | C23H12Br3NO4 |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 602.83 |
| IUPAC Name | [2,6-dibromo-4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | O=C1OC(c2ccccc2Br)=N/C1=C\c1cc(Br)c(OC(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H12Br3NO4/c24-16-9-5-4-8-15(16)21-27-19(23(29)31-21)12-13-10-17(25)20(18(26)11-13)30-22(28)14-6-2-1-3-7-14/h1-12H/b19-12- |
| InChIKey | NSYLBLLFCBRMSD-UNOMPAQXSA-N |
| XLogP | 6.54 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|