C25H17BrINO5 — CID 19669593
[4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] 3-methylbenzoate (PubChem CID 19669593) has the molecular formula C25H17BrINO5 and a molecular weight of 618.22 g/mol. Its IUPAC name is [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 19669593 |
| Molecular Formula | C25H17BrINO5 |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 616.93 |
| IUPAC Name | [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] 3-methylbenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3Br)OC2=O)cc(I)c1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C25H17BrINO5/c1-14-6-5-7-16(10-14)24(29)32-22-19(27)11-15(13-21(22)31-2)12-20-25(30)33-23(28-20)17-8-3-4-9-18(17)26/h3-13H,1-2H3/b20-12- |
| InChIKey | YCLXSDGHRHQCBI-NDENLUEZSA-N |
| XLogP | 5.93 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|