C26H19IN2O7 — CID 19667191
[2-iodo-6-methoxy-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 19667191) has the molecular formula C26H19IN2O7 and a molecular weight of 598.35 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [2-iodo-6-methoxy-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19667191 |
| Molecular Formula | C26H19IN2O7 |
| Molecular Weight | 598.35 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | [2-iodo-6-methoxy-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3cccc([N+](=O)[O-])c3C)OC2=O)cc(I)c1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C26H19IN2O7/c1-14-7-4-5-8-17(14)25(30)35-23-19(27)11-16(13-22(23)34-3)12-20-26(31)36-24(28-20)18-9-6-10-21(15(18)2)29(32)33/h4-13H,1-3H3/b20-12- |
| InChIKey | KYGSDWZERHKUJQ-NDENLUEZSA-N |
| XLogP | 5.39 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|