C24H13Br2ClN2O6 — CID 19667171
[2,6-dibromo-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 19667171) has the molecular formula C24H13Br2ClN2O6 and a molecular weight of 620.64 g/mol. Its IUPAC name is [2,6-dibromo-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2,6-dibromo-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 19667171 |
| Molecular Formula | C24H13Br2ClN2O6 |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 617.88 |
| IUPAC Name | [2,6-dibromo-4-[(Z)-[2-(2-methyl-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | Cc1c(C2=N/C(=C\c3cc(Br)c(OC(=O)c4ccc(Cl)cc4)c(Br)c3)C(=O)O2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H13Br2ClN2O6/c1-12-16(3-2-4-20(12)29(32)33)22-28-19(24(31)35-22)11-13-9-17(25)21(18(26)10-13)34-23(30)14-5-7-15(27)8-6-14/h2-11H,1H3/b19-11- |
| InChIKey | YREDEUBBKPPSAP-ODLFYWEKSA-N |
| XLogP | 6.65 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|