C25H16BrClN2O7 — CID 19664709
[2-bromo-6-ethoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 19664709) has the molecular formula C25H16BrClN2O7 and a molecular weight of 571.77 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 19664709 |
| Molecular Formula | C25H16BrClN2O7 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 569.98 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3cccc([N+](=O)[O-])c3)OC2=O)cc(Br)c1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16BrClN2O7/c1-2-34-21-12-14(10-19(26)22(21)35-24(30)15-6-8-17(27)9-7-15)11-20-25(31)36-23(28-20)16-4-3-5-18(13-16)29(32)33/h3-13H,2H2,1H3/b20-11- |
| InChIKey | JEPAIKJBJHNSQG-JAIQZWGSSA-N |
| XLogP | 5.97 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|