C26H20ClNO6 — CID 2299585
[2-ethoxy-4-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 2299585) has the molecular formula C26H20ClNO6 and a molecular weight of 477.90 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2299585 |
| Molecular Formula | C26H20ClNO6 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3cccc(OC)c3)OC2=O)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClNO6/c1-3-32-23-14-16(7-12-22(23)33-25(29)17-8-10-19(27)11-9-17)13-21-26(30)34-24(28-21)18-5-4-6-20(15-18)31-2/h4-15H,3H2,1-2H3/b21-13- |
| InChIKey | RCBIQIYIMAETKE-BKUYFWCQSA-N |
| XLogP | 5.31 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|