C28H22ClNO8 — CID 126196876
[4-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate (PubChem CID 126196876) has the molecular formula C28H22ClNO8 and a molecular weight of 535.94 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126196876 |
| Molecular Formula | C28H22ClNO8 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | [4-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(OC(C)=O)c(OC)c3)OC2=O)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H22ClNO8/c1-4-35-25-14-17(5-11-23(25)37-27(32)18-6-9-20(29)10-7-18)13-21-28(33)38-26(30-21)19-8-12-22(36-16(2)31)24(15-19)34-3/h5-15H,4H2,1-3H3/b21-13- |
| InChIKey | UDWBMTNZGZDNMA-BKUYFWCQSA-N |
| XLogP | 5.24 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|