C26H20FNO5 — CID 3859759
[2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-fluorobenzoate (PubChem CID 3859759) has the molecular formula C26H20FNO5 and a molecular weight of 445.45 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 3859759 |
| Molecular Formula | C26H20FNO5 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-fluorobenzoate |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(C)cc3)OC2=O)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20FNO5/c1-3-31-23-15-17(6-13-22(23)32-25(29)19-9-11-20(27)12-10-19)14-21-26(30)33-24(28-21)18-7-4-16(2)5-8-18/h4-15H,3H2,1-2H3 |
| InChIKey | MVSTXZCFSVQGLB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|