C27H22FNO6 — CID 126015752
[2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 126015752) has the molecular formula C27H22FNO6 and a molecular weight of 475.47 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 126015752 |
| Molecular Formula | C27H22FNO6 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccccc4F)c(OCC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H22FNO6/c1-3-32-19-12-10-18(11-13-19)25-29-22(27(31)35-25)15-17-9-14-23(24(16-17)33-4-2)34-26(30)20-7-5-6-8-21(20)28/h5-16H,3-4H2,1-2H3/b22-15- |
| InChIKey | XYQAMOKOWSZLCN-JCMHNJIXSA-N |
| XLogP | 5.19 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|