C27H23ClFNO5 — CID 126015629
(4E)-4-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 126015629) has the molecular formula C27H23ClFNO5 and a molecular weight of 495.93 g/mol. Its IUPAC name is (4E)-4-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 126015629 |
| Molecular Formula | C27H23ClFNO5 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (4E)-4-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C/c3ccc(OCc4c(F)cccc4Cl)c(OCC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H23ClFNO5/c1-3-32-19-11-9-18(10-12-19)26-30-23(27(31)35-26)14-17-8-13-24(25(15-17)33-4-2)34-16-20-21(28)6-5-7-22(20)29/h5-15H,3-4,16H2,1-2H3/b23-14+ |
| InChIKey | RMNMWJYWSJVXFD-OEAKJJBVSA-N |
| XLogP | 6.20 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|