C20H17Cl2NO4 — CID 19672590
(4Z)-2-(3,4-dichlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19672590) has the molecular formula C20H17Cl2NO4 and a molecular weight of 406.27 g/mol. Its IUPAC name is (4Z)-2-(3,4-dichlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19672590 |
| Molecular Formula | C20H17Cl2NO4 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)cc1OCC |
| InChI | InChI=1S/C20H17Cl2NO4/c1-3-25-17-8-5-12(10-18(17)26-4-2)9-16-20(24)27-19(23-16)13-6-7-14(21)15(22)11-13/h5-11H,3-4H2,1-2H3/b16-9- |
| InChIKey | MTEJKRVDRJONIP-SXGWCWSVSA-N |
| XLogP | 5.14 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|