C25H18Cl2FNO4 — CID 5163057
2-(3,4-dichlorophenyl)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 5163057) has the molecular formula C25H18Cl2FNO4 and a molecular weight of 486.33 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(3,4-dichlorophenyl)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5163057 |
| Molecular Formula | C25H18Cl2FNO4 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(Cl)c(Cl)c3)OC2=O)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C25H18Cl2FNO4/c1-2-31-23-12-15(6-9-22(23)32-14-16-4-3-5-18(28)10-16)11-21-25(30)33-24(29-21)17-7-8-19(26)20(27)13-17/h3-13H,2,14H2,1H3 |
| InChIKey | KCBXLBDSTWMOLT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|