C23H12Cl2FI2NO3 — CID 19672726
(4Z)-2-(3,4-dichlorophenyl)-4-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19672726) has the molecular formula C23H12Cl2FI2NO3 and a molecular weight of 694.06 g/mol. Its IUPAC name is (4Z)-2-(3,4-dichlorophenyl)-4-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dichlorophenyl)-4-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19672726 |
| Molecular Formula | C23H12Cl2FI2NO3 |
| Molecular Weight | 694.06 g/mol |
| Exact Mass | 692.83 |
| IUPAC Name | (4Z)-2-(3,4-dichlorophenyl)-4-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)c(Cl)c2)=N/C1=C\c1cc(I)c(OCc2cccc(F)c2)c(I)c1 |
| InChI | InChI=1S/C23H12Cl2FI2NO3/c24-16-5-4-14(10-17(16)25)22-29-20(23(30)32-22)9-13-7-18(27)21(19(28)8-13)31-11-12-2-1-3-15(26)6-12/h1-10H,11H2/b20-9- |
| InChIKey | WNUJJLPHVVQORT-UKWGHVSLSA-N |
| XLogP | 7.27 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.06 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|