C22H21NO6 — CID 2694656
(4Z)-2-(3,4-diethoxyphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 2694656) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is (4Z)-2-(3,4-diethoxyphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-diethoxyphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2694656 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (4Z)-2-(3,4-diethoxyphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc4c(c3)OCCO4)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C22H21NO6/c1-3-25-17-8-6-15(13-20(17)26-4-2)21-23-16(22(24)29-21)11-14-5-7-18-19(12-14)28-10-9-27-18/h5-8,11-13H,3-4,9-10H2,1-2H3/b16-11- |
| InChIKey | ABVDSHBGOVTSNA-WJDWOHSUSA-N |
| XLogP | 3.60 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|