C28H23NO8 — CID 126199405
[2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126199405) has the molecular formula C28H23NO8 and a molecular weight of 501.49 g/mol. Its IUPAC name is [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126199405 |
| Molecular Formula | C28H23NO8 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccccc3OC(=O)c3ccc4c(c3)OCO4)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C28H23NO8/c1-3-32-22-11-9-18(14-24(22)33-4-2)26-29-20(28(31)37-26)13-17-7-5-6-8-21(17)36-27(30)19-10-12-23-25(15-19)35-16-34-23/h5-15H,3-4,16H2,1-2H3/b20-13- |
| InChIKey | DQTOFRFBELHHFO-MOSHPQCFSA-N |
| XLogP | 4.78 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|