C24H13BrClNO6 — CID 6310839
[4-bromo-2-[(Z)-[2-(4-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 6310839) has the molecular formula C24H13BrClNO6 and a molecular weight of 526.73 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[2-(4-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-bromo-2-[(Z)-[2-(4-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 6310839 |
| Molecular Formula | C24H13BrClNO6 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 524.96 |
| IUPAC Name | [4-bromo-2-[(Z)-[2-(4-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C1OC(c2ccc(Cl)cc2)=N/C1=C\c1cc(Br)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H13BrClNO6/c25-16-4-8-19(32-23(28)14-3-7-20-21(11-14)31-12-30-20)15(9-16)10-18-24(29)33-22(27-18)13-1-5-17(26)6-2-13/h1-11H,12H2/b18-10- |
| InChIKey | LIXZHSVOQZDNBT-ZDLGFXPLSA-N |
| XLogP | 5.39 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|