C25H17NO7 — CID 126199505
[2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126199505) has the molecular formula C25H17NO7 and a molecular weight of 443.41 g/mol. Its IUPAC name is [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126199505 |
| Molecular Formula | C25H17NO7 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2/C=C2/N=C(c3ccc4c(c3)OCO4)OC2=O)cc1 |
| InChI | InChI=1S/C25H17NO7/c1-29-18-9-6-15(7-10-18)24(27)32-20-5-3-2-4-16(20)12-19-25(28)33-23(26-19)17-8-11-21-22(13-17)31-14-30-21/h2-13H,14H2,1H3/b19-12+ |
| InChIKey | IFTWDMRYNYUJMA-XDHOZWIPSA-N |
| XLogP | 3.99 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|